C16H23NO — CID 175084123
(1S,9S,12S)-10-ethyl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 175084123) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1S,9S,12S)-10-ethyl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1S,9S,12S)-10-ethyl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 175084123 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1S,9S,12S)-10-ethyl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | CCN1C[C@@H](C)[C@@H]2C[C@H]1Cc1ccc(OC)cc12 |
| InChI | InChI=1S/C16H23NO/c1-4-17-10-11(2)15-8-13(17)7-12-5-6-14(18-3)9-16(12)15/h5-6,9,11,13,15H,4,7-8,10H2,1-3H3/t11-,13-,15+/m1/s1 |
| InChIKey | FEDIUGVSINRTJQ-KYOSRNDESA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |