C22H30N2O2 — CID 11013665
(2S,3R)-1,4-diethyl-2,3-bis(4-methoxyphenyl)piperazine (PubChem CID 11013665) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2S,3R)-1,4-diethyl-2,3-bis(4-methoxyphenyl)piperazine.
| Compound Name | (2S,3R)-1,4-diethyl-2,3-bis(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 11013665 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (2S,3R)-1,4-diethyl-2,3-bis(4-methoxyphenyl)piperazine |
| SMILES | CCN1CCN(CC)[C@@H](c2ccc(OC)cc2)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-5-23-15-16-24(6-2)22(18-9-13-20(26-4)14-10-18)21(23)17-7-11-19(25-3)12-8-17/h7-14,21-22H,5-6,15-16H2,1-4H3/t21-,22+ |
| InChIKey | JRZZNLZAKWRPFR-SZPZYZBQSA-N |
| XLogP | 4.14 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |