C19H23NO3 — CID 92859022
(2R,3S)-4-ethyl-3-(4-methoxyphenyl)-2-phenylmorpholin-2-ol (PubChem CID 92859022) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2R,3S)-4-ethyl-3-(4-methoxyphenyl)-2-phenylmorpholin-2-ol.
| Compound Name | (2R,3S)-4-ethyl-3-(4-methoxyphenyl)-2-phenylmorpholin-2-ol |
|---|---|
| PubChem CID | 92859022 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2R,3S)-4-ethyl-3-(4-methoxyphenyl)-2-phenylmorpholin-2-ol |
| SMILES | CCN1CCO[C@](O)(c2ccccc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-3-20-13-14-23-19(21,16-7-5-4-6-8-16)18(20)15-9-11-17(22-2)12-10-15/h4-12,18,21H,3,13-14H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | MDPIBSWCGDZSOV-RBUKOAKNSA-N |
| XLogP | 2.93 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |