C20H25NO4 — CID 141298274
4-(2-hydroxyethyl)-3-methyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol (PubChem CID 141298274) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-3-methyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol.
| Compound Name | 4-(2-hydroxyethyl)-3-methyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol |
|---|---|
| PubChem CID | 141298274 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-(2-hydroxyethyl)-3-methyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol |
| SMILES | CC1N(CCO)CCOC1(O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-16-20(23,25-14-12-21(16)11-13-22)18-7-9-19(10-8-18)24-15-17-5-3-2-4-6-17/h2-10,16,22-23H,11-15H2,1H3 |
| InChIKey | FCCHOLLPRVYMOX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |