C19H23NO3 — CID 102404566
(2S,3S,5R)-3,5-dimethyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol (PubChem CID 102404566) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S,3S,5R)-3,5-dimethyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol.
| Compound Name | (2S,3S,5R)-3,5-dimethyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol |
|---|---|
| PubChem CID | 102404566 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2S,3S,5R)-3,5-dimethyl-2-(4-phenylmethoxyphenyl)morpholin-2-ol |
| SMILES | C[C@@H]1CO[C@@](O)(c2ccc(OCc3ccccc3)cc2)[C@H](C)N1 |
| InChI | InChI=1S/C19H23NO3/c1-14-12-23-19(21,15(2)20-14)17-8-10-18(11-9-17)22-13-16-6-4-3-5-7-16/h3-11,14-15,20-21H,12-13H2,1-2H3/t14-,15+,19-/m1/s1 |
| InChIKey | KMXGPEVCFSFVED-ZRGWGRIASA-N |
| XLogP | 2.81 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |