C22H29NO7S — CID 71542910
5-(4-phenylmethoxyphenyl)-9-propyl-4,6-dioxa-1-azabicyclo[3.3.1]nonane;sulfuric acid (PubChem CID 71542910) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is 5-(4-phenylmethoxyphenyl)-9-propyl-4,6-dioxa-1-azabicyclo[3.3.1]nonane;sulfuric acid.
| Compound Name | 5-(4-phenylmethoxyphenyl)-9-propyl-4,6-dioxa-1-azabicyclo[3.3.1]nonane;sulfuric acid |
|---|---|
| PubChem CID | 71542910 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-(4-phenylmethoxyphenyl)-9-propyl-4,6-dioxa-1-azabicyclo[3.3.1]nonane;sulfuric acid |
| SMILES | CCCC1N2CCOC1(c1ccc(OCc3ccccc3)cc1)OCC2.O=S(=O)(O)O |
| InChI | InChI=1S/C22H27NO3.H2O4S/c1-2-6-21-22(25-15-13-23(21)14-16-26-22)19-9-11-20(12-10-19)24-17-18-7-4-3-5-8-18;1-5(2,3)4/h3-5,7-12,21H,2,6,13-17H2,1H3;(H2,1,2,3,4) |
| InChIKey | KYVVAUKOHODQGF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|