C25H33NO6S — CID 141305444
[4,6-dihydroxy-5-(4-phenylmethoxyphenyl)-9-propyl-1-azabicyclo[3.3.1]nonan-2-yl] methanesulfonate (PubChem CID 141305444) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is [4,6-dihydroxy-5-(4-phenylmethoxyphenyl)-9-propyl-1-azabicyclo[3.3.1]nonan-2-yl] methanesulfonate.
| Compound Name | [4,6-dihydroxy-5-(4-phenylmethoxyphenyl)-9-propyl-1-azabicyclo[3.3.1]nonan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 141305444 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [4,6-dihydroxy-5-(4-phenylmethoxyphenyl)-9-propyl-1-azabicyclo[3.3.1]nonan-2-yl] methanesulfonate |
| SMILES | CCCC1N2CCC(O)C1(c1ccc(OCc3ccccc3)cc1)C(O)CC2OS(C)(=O)=O |
| InChI | InChI=1S/C25H33NO6S/c1-3-7-21-25(19-10-12-20(13-11-19)31-17-18-8-5-4-6-9-18)22(27)14-15-26(21)24(16-23(25)28)32-33(2,29)30/h4-6,8-13,21-24,27-28H,3,7,14-17H2,1-2H3 |
| InChIKey | CXLBCPFJHYAIMX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|