C18H21NO2 — CID 129362083
(3S,5S)-5-methyl-3-(4-phenylmethoxyphenyl)pyrrolidin-3-ol (PubChem CID 129362083) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3S,5S)-5-methyl-3-(4-phenylmethoxyphenyl)pyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-methyl-3-(4-phenylmethoxyphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129362083 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3S,5S)-5-methyl-3-(4-phenylmethoxyphenyl)pyrrolidin-3-ol |
| SMILES | C[C@H]1C[C@](O)(c2ccc(OCc3ccccc3)cc2)CN1 |
| InChI | InChI=1S/C18H21NO2/c1-14-11-18(20,13-19-14)16-7-9-17(10-8-16)21-12-15-5-3-2-4-6-15/h2-10,14,19-20H,11-13H2,1H3/t14-,18+/m0/s1 |
| InChIKey | GJVFYFULSAEJSE-KBXCAEBGSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |