C20H27NO3 — CID 174770002
ethane;4-hydroxy-3-methyl-2-(4-phenylmethoxyphenyl)morpholine (PubChem CID 174770002) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethane;4-hydroxy-3-methyl-2-(4-phenylmethoxyphenyl)morpholine.
| Compound Name | ethane;4-hydroxy-3-methyl-2-(4-phenylmethoxyphenyl)morpholine |
|---|---|
| PubChem CID | 174770002 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethane;4-hydroxy-3-methyl-2-(4-phenylmethoxyphenyl)morpholine |
| SMILES | CC.CC1C(c2ccc(OCc3ccccc3)cc2)OCCN1O |
| InChI | InChI=1S/C18H21NO3.C2H6/c1-14-18(21-12-11-19(14)20)16-7-9-17(10-8-16)22-13-15-5-3-2-4-6-15;1-2/h2-10,14,18,20H,11-13H2,1H3;1-2H3 |
| InChIKey | ATGTUERADMRPKO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |