C29H28N2O2 — CID 10961096
(4S,5R)-4,5-bis(4-methoxyphenyl)-1,3-diphenylimidazolidine (PubChem CID 10961096) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(4-methoxyphenyl)-1,3-diphenylimidazolidine.
| Compound Name | (4S,5R)-4,5-bis(4-methoxyphenyl)-1,3-diphenylimidazolidine |
|---|---|
| PubChem CID | 10961096 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (4S,5R)-4,5-bis(4-methoxyphenyl)-1,3-diphenylimidazolidine |
| SMILES | COc1ccc([C@@H]2[C@H](c3ccc(OC)cc3)N(c3ccccc3)CN2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28N2O2/c1-32-26-17-13-22(14-18-26)28-29(23-15-19-27(33-2)20-16-23)31(25-11-7-4-8-12-25)21-30(28)24-9-5-3-6-10-24/h3-20,28-29H,21H2,1-2H3/t28-,29+ |
| InChIKey | AEECRSKFUFPPSJ-ISILISOKSA-N |
| XLogP | 6.47 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |