C19H21NO3 — CID 10495239
(2R,3R)-2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)-3-phenylazetidine (PubChem CID 10495239) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2R,3R)-2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)-3-phenylazetidine.
| Compound Name | (2R,3R)-2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)-3-phenylazetidine |
|---|---|
| PubChem CID | 10495239 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2R,3R)-2-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)-3-phenylazetidine |
| SMILES | COc1ccc(N2C[C@@H](c3ccccc3)[C@@H]2C2OCCO2)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-21-16-9-7-15(8-10-16)20-13-17(14-5-3-2-4-6-14)18(20)19-22-11-12-23-19/h2-10,17-19H,11-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | URNKCEADGZFQQV-ZWKOTPCHSA-N |
| XLogP | 3.04 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|