C16H16N2O2 — CID 102509143
3-(4-methoxyphenyl)-1-oxido-2-phenyl-2,4-dihydroimidazol-1-ium (PubChem CID 102509143) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-oxido-2-phenyl-2,4-dihydroimidazol-1-ium.
| Compound Name | 3-(4-methoxyphenyl)-1-oxido-2-phenyl-2,4-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 102509143 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-oxido-2-phenyl-2,4-dihydroimidazol-1-ium |
| SMILES | COc1ccc(N2CC=[N+]([O-])C2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-20-15-9-7-14(8-10-15)17-11-12-18(19)16(17)13-5-3-2-4-6-13/h2-10,12,16H,11H2,1H3 |
| InChIKey | HDGLTCXXDDRXNN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|