C22H20N2O — CID 164624389
(4S)-1-(4-methoxyphenyl)-N,4-diphenylazetidin-2-imine (PubChem CID 164624389) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (4S)-1-(4-methoxyphenyl)-N,4-diphenylazetidin-2-imine.
| Compound Name | (4S)-1-(4-methoxyphenyl)-N,4-diphenylazetidin-2-imine |
|---|---|
| PubChem CID | 164624389 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (4S)-1-(4-methoxyphenyl)-N,4-diphenylazetidin-2-imine |
| SMILES | COc1ccc(N2/C(=N/c3ccccc3)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-25-20-14-12-19(13-15-20)24-21(17-8-4-2-5-9-17)16-22(24)23-18-10-6-3-7-11-18/h2-15,21H,16H2,1H3/b23-22+/t21-/m0/s1 |
| InChIKey | GDDAGDFGUCWONA-JSMIYBGHSA-N |
| XLogP | 5.38 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|