C26H24N4O2 — CID 15366597
6-amino-1-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-phenyl-3,4-dihydropyridine-5-carbonitrile (PubChem CID 15366597) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 6-amino-1-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-phenyl-3,4-dihydropyridine-5-carbonitrile.
| Compound Name | 6-amino-1-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-phenyl-3,4-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 15366597 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-amino-1-(4-methoxyphenyl)-2-(4-methoxyphenyl)imino-4-phenyl-3,4-dihydropyridine-5-carbonitrile |
| SMILES | COc1ccc(/N=C2\CC(c3ccccc3)C(C#N)=C(N)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-31-21-12-8-19(9-13-21)29-25-16-23(18-6-4-3-5-7-18)24(17-27)26(28)30(25)20-10-14-22(32-2)15-11-20/h3-15,23H,16,28H2,1-2H3/b29-25+ |
| InChIKey | VPCVIXKGHSDWFA-XLVZBRSZSA-N |
| XLogP | 5.12 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|