C26H27N3O6 — CID 137332333
diethyl 6-amino-5-cyano-1,4-bis(4-methoxyphenyl)-4H-pyridine-2,3-dicarboxylate (PubChem CID 137332333) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is diethyl 6-amino-5-cyano-1,4-bis(4-methoxyphenyl)-4H-pyridine-2,3-dicarboxylate.
| Compound Name | diethyl 6-amino-5-cyano-1,4-bis(4-methoxyphenyl)-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 137332333 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | diethyl 6-amino-5-cyano-1,4-bis(4-methoxyphenyl)-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(c2ccc(OC)cc2)C(N)=C(C#N)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27N3O6/c1-5-34-25(30)22-21(16-7-11-18(32-3)12-8-16)20(15-27)24(28)29(23(22)26(31)35-6-2)17-9-13-19(33-4)14-10-17/h7-14,21H,5-6,28H2,1-4H3 |
| InChIKey | CSOLSINRAHRDTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |