C28H24BrClN4O5 — CID 137332342
diethyl 6-amino-1-(4-bromophenyl)-4-(2-chloro-7-methoxyquinolin-3-yl)-5-cyano-4H-pyridine-2,3-dicarboxylate (PubChem CID 137332342) has the molecular formula C28H24BrClN4O5 and a molecular weight of 611.88 g/mol. Its IUPAC name is diethyl 6-amino-1-(4-bromophenyl)-4-(2-chloro-7-methoxyquinolin-3-yl)-5-cyano-4H-pyridine-2,3-dicarboxylate.
| Compound Name | diethyl 6-amino-1-(4-bromophenyl)-4-(2-chloro-7-methoxyquinolin-3-yl)-5-cyano-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 137332342 |
| Molecular Formula | C28H24BrClN4O5 |
| Molecular Weight | 611.88 g/mol |
| Exact Mass | 610.06 |
| IUPAC Name | diethyl 6-amino-1-(4-bromophenyl)-4-(2-chloro-7-methoxyquinolin-3-yl)-5-cyano-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(c2ccc(Br)cc2)C(N)=C(C#N)C1c1cc2ccc(OC)cc2nc1Cl |
| InChI | InChI=1S/C28H24BrClN4O5/c1-4-38-27(35)23-22(19-12-15-6-11-18(37-3)13-21(15)33-25(19)30)20(14-31)26(32)34(24(23)28(36)39-5-2)17-9-7-16(29)8-10-17/h6-13,22H,4-5,32H2,1-3H3 |
| InChIKey | ORQIUGKLEDVRQU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|