C20H17Cl2N3O3 — CID 1130170
ethyl (4S)-6-amino-2-(chloromethyl)-4-(2-chloro-7-methylquinolin-3-yl)-5-cyano-4H-pyran-3-carboxylate (PubChem CID 1130170) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is ethyl (4S)-6-amino-2-(chloromethyl)-4-(2-chloro-7-methylquinolin-3-yl)-5-cyano-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-6-amino-2-(chloromethyl)-4-(2-chloro-7-methylquinolin-3-yl)-5-cyano-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1130170 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl (4S)-6-amino-2-(chloromethyl)-4-(2-chloro-7-methylquinolin-3-yl)-5-cyano-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCl)OC(N)=C(C#N)[C@@H]1c1cc2ccc(C)cc2nc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-3-27-20(26)17-15(8-21)28-19(24)13(9-23)16(17)12-7-11-5-4-10(2)6-14(11)25-18(12)22/h4-7,16H,3,8,24H2,1-2H3/t16-/m0/s1 |
| InChIKey | FYZMPDNGNGILBY-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|