C20H17Cl2N3O4 — CID 1132030
ethyl (4R)-6-amino-4-(2-chloro-7-methoxyquinolin-3-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate (PubChem CID 1132030) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is ethyl (4R)-6-amino-4-(2-chloro-7-methoxyquinolin-3-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-6-amino-4-(2-chloro-7-methoxyquinolin-3-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1132030 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | ethyl (4R)-6-amino-4-(2-chloro-7-methoxyquinolin-3-yl)-2-(chloromethyl)-5-cyano-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCl)OC(N)=C(C#N)[C@H]1c1cc2ccc(OC)cc2nc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O4/c1-3-28-20(26)17-15(8-21)29-19(24)13(9-23)16(17)12-6-10-4-5-11(27-2)7-14(10)25-18(12)22/h4-7,16H,3,8,24H2,1-2H3/t16-/m1/s1 |
| InChIKey | KUFCLJZSJHPWDQ-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|