C20H18ClN3O4 — CID 1130175
ethyl (4R)-6-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 1130175) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is ethyl (4R)-6-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-6-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1130175 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl (4R)-6-amino-4-(2-chloro-6-methoxyquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1cc2cc(OC)ccc2nc1Cl |
| InChI | InChI=1S/C20H18ClN3O4/c1-4-27-20(25)16-10(2)28-19(23)14(9-22)17(16)13-8-11-7-12(26-3)5-6-15(11)24-18(13)21/h5-8,17H,4,23H2,1-3H3/t17-/m1/s1 |
| InChIKey | INKDDAZDANENDU-QGZVFWFLSA-N |
| XLogP | 3.54 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|