C27H22N4O4 — CID 15366590
1'-(4-methoxyphenyl)-6'-(4-methoxyphenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile (PubChem CID 15366590) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 1'-(4-methoxyphenyl)-6'-(4-methoxyphenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile.
| Compound Name | 1'-(4-methoxyphenyl)-6'-(4-methoxyphenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile |
|---|---|
| PubChem CID | 15366590 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1'-(4-methoxyphenyl)-6'-(4-methoxyphenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile |
| SMILES | COc1ccc(/N=C2\CC3(C(=O)Nc4ccccc43)C(C#N)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H22N4O4/c1-34-19-11-7-17(8-12-19)29-24-15-27(21-5-3-4-6-23(21)30-26(27)33)22(16-28)25(32)31(24)18-9-13-20(35-2)14-10-18/h3-14,22H,15H2,1-2H3,(H,30,33)/b29-24+ |
| InChIKey | XZHUKMGNVNONRV-RMLRFSFXSA-N |
| XLogP | 4.20 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|