C33H20N2O4 — CID 101495320
2'-(4-methoxyphenyl)spiro[1H-indole-3,12'-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene]-2,10',14'-trione (PubChem CID 101495320) has the molecular formula C33H20N2O4 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2'-(4-methoxyphenyl)spiro[1H-indole-3,12'-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene]-2,10',14'-trione.
| Compound Name | 2'-(4-methoxyphenyl)spiro[1H-indole-3,12'-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene]-2,10',14'-trione |
|---|---|
| PubChem CID | 101495320 |
| Molecular Formula | C33H20N2O4 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2'-(4-methoxyphenyl)spiro[1H-indole-3,12'-2-azapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),3(11),4,6,8,15,17,19-octaene]-2,10',14'-trione |
| SMILES | COc1ccc(N2C3=C(C(=O)c4ccccc43)C3(C(=O)Nc4ccccc43)C3=C2c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C33H20N2O4/c1-39-19-16-14-18(15-17-19)35-28-20-8-2-4-10-22(20)30(36)26(28)33(24-12-6-7-13-25(24)34-32(33)38)27-29(35)21-9-3-5-11-23(21)31(27)37/h2-17H,1H3,(H,34,38) |
| InChIKey | QNSOHYDPXIOVBI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |