C22H16N4O4 — CID 139238134
8'-nitrospiro[1H-indole-3,9'-2,6-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),7,12,14,16-pentaene]-2,11'-dione (PubChem CID 139238134) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is 8'-nitrospiro[1H-indole-3,9'-2,6-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),7,12,14,16-pentaene]-2,11'-dione.
| Compound Name | 8'-nitrospiro[1H-indole-3,9'-2,6-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),7,12,14,16-pentaene]-2,11'-dione |
|---|---|
| PubChem CID | 139238134 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 8'-nitrospiro[1H-indole-3,9'-2,6-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),7,12,14,16-pentaene]-2,11'-dione |
| SMILES | O=C1C2=C(c3ccccc31)N1CCCNC1=C([N+](=O)[O-])C21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C22H16N4O4/c27-18-13-7-2-1-6-12(13)17-16(18)22(14-8-3-4-9-15(14)24-21(22)28)19(26(29)30)20-23-10-5-11-25(17)20/h1-4,6-9,23H,5,10-11H2,(H,24,28) |
| InChIKey | JAIWDDHNYMBPTD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|