C29H20FN3O3 — CID 71814591
5-fluoro-7'-(4-methylbenzoyl)spiro[1H-indole-3,8'-2,5-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),6,11,13,15-pentaene]-2,10'-dione (PubChem CID 71814591) has the molecular formula C29H20FN3O3 and a molecular weight of 477.50 g/mol. Its IUPAC name is 5-fluoro-7'-(4-methylbenzoyl)spiro[1H-indole-3,8'-2,5-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),6,11,13,15-pentaene]-2,10'-dione.
| Compound Name | 5-fluoro-7'-(4-methylbenzoyl)spiro[1H-indole-3,8'-2,5-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),6,11,13,15-pentaene]-2,10'-dione |
|---|---|
| PubChem CID | 71814591 |
| Molecular Formula | C29H20FN3O3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-fluoro-7'-(4-methylbenzoyl)spiro[1H-indole-3,8'-2,5-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),6,11,13,15-pentaene]-2,10'-dione |
| SMILES | Cc1ccc(C(=O)C2=C3NCCN3C3=C(C(=O)c4ccccc43)C23C(=O)Nc2ccc(F)cc23)cc1 |
| InChI | InChI=1S/C29H20FN3O3/c1-15-6-8-16(9-7-15)25(34)23-27-31-12-13-33(27)24-18-4-2-3-5-19(18)26(35)22(24)29(23)20-14-17(30)10-11-21(20)32-28(29)36/h2-11,14,31H,12-13H2,1H3,(H,32,36) |
| InChIKey | VCSWWCJJMKHYFF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |