C27H17FN4O2 — CID 135878866
5'-fluoro-12-methyl-14-phenylspiro[13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaene-10,3'-1H-indole]-2',8-dione (PubChem CID 135878866) has the molecular formula C27H17FN4O2 and a molecular weight of 448.46 g/mol. Its IUPAC name is 5'-fluoro-12-methyl-14-phenylspiro[13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaene-10,3'-1H-indole]-2',8-dione.
| Compound Name | 5'-fluoro-12-methyl-14-phenylspiro[13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaene-10,3'-1H-indole]-2',8-dione |
|---|---|
| PubChem CID | 135878866 |
| Molecular Formula | C27H17FN4O2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 5'-fluoro-12-methyl-14-phenylspiro[13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaene-10,3'-1H-indole]-2',8-dione |
| SMILES | Cc1nn(-c2ccccc2)c2c1C1(C(=O)Nc3ccc(F)cc31)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C27H17FN4O2/c1-14-21-25(32(31-14)16-7-3-2-4-8-16)30-23-17-9-5-6-10-18(17)24(33)22(23)27(21)19-13-15(28)11-12-20(19)29-26(27)34/h2-13,30H,1H3,(H,29,34) |
| InChIKey | PBEYIVAKKKQFHB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |