C27H15N3O4 — CID 46910773
5-nitrospiro[1H-indole-3,12'-2-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene]-2,10'-dione (PubChem CID 46910773) has the molecular formula C27H15N3O4 and a molecular weight of 445.43 g/mol. Its IUPAC name is 5-nitrospiro[1H-indole-3,12'-2-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene]-2,10'-dione.
| Compound Name | 5-nitrospiro[1H-indole-3,12'-2-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene]-2,10'-dione |
|---|---|
| PubChem CID | 46910773 |
| Molecular Formula | C27H15N3O4 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 5-nitrospiro[1H-indole-3,12'-2-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene]-2,10'-dione |
| SMILES | O=C1C2=C(Nc3ccc4ccccc4c3C23C(=O)Nc2ccc([N+](=O)[O-])cc23)c2ccccc21 |
| InChI | InChI=1S/C27H15N3O4/c31-25-18-8-4-3-7-17(18)24-23(25)27(19-13-15(30(33)34)10-12-20(19)29-26(27)32)22-16-6-2-1-5-14(16)9-11-21(22)28-24/h1-13,28H,(H,29,32) |
| InChIKey | QCRMRAJHUYTARM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|