C21H12N4O6 — CID 137279413
13'-methyl-5-nitrospiro[1H-indole-3,11'-8,15-dioxa-14,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene]-2,9'-dione (PubChem CID 137279413) has the molecular formula C21H12N4O6 and a molecular weight of 416.35 g/mol. Its IUPAC name is 13'-methyl-5-nitrospiro[1H-indole-3,11'-8,15-dioxa-14,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene]-2,9'-dione.
| Compound Name | 13'-methyl-5-nitrospiro[1H-indole-3,11'-8,15-dioxa-14,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene]-2,9'-dione |
|---|---|
| PubChem CID | 137279413 |
| Molecular Formula | C21H12N4O6 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 13'-methyl-5-nitrospiro[1H-indole-3,11'-8,15-dioxa-14,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12(16),13-hexaene]-2,9'-dione |
| SMILES | Cc1noc2c1C1(C(=O)Nc3ccc([N+](=O)[O-])cc31)c1c(c3ccccc3oc1=O)N2 |
| InChI | InChI=1S/C21H12N4O6/c1-9-15-18(31-24-9)23-17-11-4-2-3-5-14(11)30-19(26)16(17)21(15)12-8-10(25(28)29)6-7-13(12)22-20(21)27/h2-8,23H,1H3,(H,22,27) |
| InChIKey | KBELTUDDLBPPJJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 140.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|