C27H15NO6 — CID 122374997
5-methylspiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene]-2,11',15'-trione (PubChem CID 122374997) has the molecular formula C27H15NO6 and a molecular weight of 449.42 g/mol. Its IUPAC name is 5-methylspiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene]-2,11',15'-trione.
| Compound Name | 5-methylspiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene]-2,11',15'-trione |
|---|---|
| PubChem CID | 122374997 |
| Molecular Formula | C27H15NO6 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 5-methylspiro[1H-indole-3,13'-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene]-2,11',15'-trione |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2)c2c(c3ccccc3oc2=O)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C27H15NO6/c1-13-10-11-17-16(12-13)27(26(31)28-17)20-22(14-6-2-4-8-18(14)32-24(20)29)34-23-15-7-3-5-9-19(15)33-25(30)21(23)27/h2-12H,1H3,(H,28,31) |
| InChIKey | HVHOPVABOUAJHA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|