C23H17BrN2O7 — CID 171985469
2-methoxyethyl 2'-amino-5-bromo-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate (PubChem CID 171985469) has the molecular formula C23H17BrN2O7 and a molecular weight of 513.30 g/mol. Its IUPAC name is 2-methoxyethyl 2'-amino-5-bromo-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate.
| Compound Name | 2-methoxyethyl 2'-amino-5-bromo-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
|---|---|
| PubChem CID | 171985469 |
| Molecular Formula | C23H17BrN2O7 |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 2-methoxyethyl 2'-amino-5-bromo-2,5'-dioxospiro[1H-indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
| SMILES | COCCOC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)C12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C23H17BrN2O7/c1-30-8-9-31-20(27)17-19(25)33-18-12-4-2-3-5-15(12)32-21(28)16(18)23(17)13-10-11(24)6-7-14(13)26-22(23)29/h2-7,10H,8-9,25H2,1H3,(H,26,29) |
| InChIKey | HLZWWVDHCGYTMV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|