C23H15BrN2O6 — CID 54590009
ethyl 2'-amino-5-bromo-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carboxylate (PubChem CID 54590009) has the molecular formula C23H15BrN2O6 and a molecular weight of 495.29 g/mol. Its IUPAC name is ethyl 2'-amino-5-bromo-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carboxylate.
| Compound Name | ethyl 2'-amino-5-bromo-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carboxylate |
|---|---|
| PubChem CID | 54590009 |
| Molecular Formula | C23H15BrN2O6 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | ethyl 2'-amino-5-bromo-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC2=C(C(=O)c3ccccc3C2=O)C12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C23H15BrN2O6/c1-2-31-21(29)16-20(25)32-19-15(17(27)11-5-3-4-6-12(11)18(19)28)23(16)13-9-10(24)7-8-14(13)26-22(23)30/h3-9H,2,25H2,1H3,(H,26,30) |
| InChIKey | ZMSQOOVOHFNTNQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|