C15H11N7O3 — CID 135952992
(3R)-6'-amino-3'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-2,7-dihydropyrazolo[3,4-b]pyridine]-5'-carbonitrile (PubChem CID 135952992) has the molecular formula C15H11N7O3 and a molecular weight of 337.30 g/mol. Its IUPAC name is (3R)-6'-amino-3'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-2,7-dihydropyrazolo[3,4-b]pyridine]-5'-carbonitrile.
| Compound Name | (3R)-6'-amino-3'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-2,7-dihydropyrazolo[3,4-b]pyridine]-5'-carbonitrile |
|---|---|
| PubChem CID | 135952992 |
| Molecular Formula | C15H11N7O3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (3R)-6'-amino-3'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-2,7-dihydropyrazolo[3,4-b]pyridine]-5'-carbonitrile |
| SMILES | Cc1[nH]nc2c1[C@@]1(C(=O)Nc3ccc([N+](=O)[O-])cc31)C(C#N)=C(N)N2 |
| InChI | InChI=1S/C15H11N7O3/c1-6-11-13(21-20-6)19-12(17)9(5-16)15(11)8-4-7(22(24)25)2-3-10(8)18-14(15)23/h2-4H,17H2,1H3,(H,18,23)(H2,19,20,21)/t15-/m0/s1 |
| InChIKey | ZOTCUIMTYUFAAP-HNNXBMFYSA-N |
| XLogP | 0.98 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|