C18H14N6O6 — CID 40983763
ethyl 2-[(3R)-6'-amino-5'-cyano-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-3'-yl]acetate (PubChem CID 40983763) has the molecular formula C18H14N6O6 and a molecular weight of 410.35 g/mol. Its IUPAC name is ethyl 2-[(3R)-6'-amino-5'-cyano-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-3'-yl]acetate.
| Compound Name | ethyl 2-[(3R)-6'-amino-5'-cyano-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-3'-yl]acetate |
|---|---|
| PubChem CID | 40983763 |
| Molecular Formula | C18H14N6O6 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | ethyl 2-[(3R)-6'-amino-5'-cyano-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-3'-yl]acetate |
| SMILES | CCOC(=O)Cc1[nH]nc2c1[C@]1(C(=O)Nc3ccc([N+](=O)[O-])cc31)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C18H14N6O6/c1-2-29-13(25)6-12-14-16(23-22-12)30-15(20)10(7-19)18(14)9-5-8(24(27)28)3-4-11(9)21-17(18)26/h3-5H,2,6,20H2,1H3,(H,21,26)(H,22,23)/t18-/m1/s1 |
| InChIKey | HPBKCHCFAOUACO-GOSISDBHSA-N |
| XLogP | 0.75 |
| TPSA | 186.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|