C17H14N4O6 — CID 23768769
ethyl 6'-amino-2'-cyano-5'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate (PubChem CID 23768769) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is ethyl 6'-amino-2'-cyano-5'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate.
| Compound Name | ethyl 6'-amino-2'-cyano-5'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
|---|---|
| PubChem CID | 23768769 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | ethyl 6'-amino-2'-cyano-5'-methyl-5-nitro-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(C#N)OC(N)=C(C)C12C(=O)Nc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H14N4O6/c1-3-26-15(22)13-12(7-18)27-14(19)8(2)17(13)10-6-9(21(24)25)4-5-11(10)20-16(17)23/h4-6H,3,19H2,1-2H3,(H,20,23) |
| InChIKey | WGLNAMHASHCZRR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|