C25H15N3O7 — CID 71654332
methyl 10'-amino-5-nitro-2,7'-dioxospiro[1H-indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate (PubChem CID 71654332) has the molecular formula C25H15N3O7 and a molecular weight of 469.41 g/mol. Its IUPAC name is methyl 10'-amino-5-nitro-2,7'-dioxospiro[1H-indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate.
| Compound Name | methyl 10'-amino-5-nitro-2,7'-dioxospiro[1H-indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate |
|---|---|
| PubChem CID | 71654332 |
| Molecular Formula | C25H15N3O7 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | methyl 10'-amino-5-nitro-2,7'-dioxospiro[1H-indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate |
| SMILES | COC(=O)C1=C(N)OC2=C(C(=O)c3cccc4cccc2c34)C12C(=O)Nc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C25H15N3O7/c1-34-23(30)19-22(26)35-21-14-7-3-5-11-4-2-6-13(17(11)14)20(29)18(21)25(19)15-10-12(28(32)33)8-9-16(15)27-24(25)31/h2-10H,26H2,1H3,(H,27,31) |
| InChIKey | COEZLWREILYFJJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|