C27H19N3O7 — CID 139213995
ethyl 10'-amino-1-methyl-5-nitro-2,7'-dioxospiro[indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate (PubChem CID 139213995) has the molecular formula C27H19N3O7 and a molecular weight of 497.46 g/mol. Its IUPAC name is ethyl 10'-amino-1-methyl-5-nitro-2,7'-dioxospiro[indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate.
| Compound Name | ethyl 10'-amino-1-methyl-5-nitro-2,7'-dioxospiro[indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate |
|---|---|
| PubChem CID | 139213995 |
| Molecular Formula | C27H19N3O7 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | ethyl 10'-amino-1-methyl-5-nitro-2,7'-dioxospiro[indole-3,8'-phenaleno[1,2-b]pyran]-9'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC2=C(C(=O)c3cccc4cccc2c34)C12C(=O)N(C)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C27H19N3O7/c1-3-36-25(32)21-24(28)37-23-16-9-5-7-13-6-4-8-15(19(13)16)22(31)20(23)27(21)17-12-14(30(34)35)10-11-18(17)29(2)26(27)33/h4-12H,3,28H2,1-2H3 |
| InChIKey | DIRXBTQOLQZUGF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|