C22H19N3O5S — CID 132584760
ethyl 1-ethyl-5-nitro-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate (PubChem CID 132584760) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is ethyl 1-ethyl-5-nitro-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate.
| Compound Name | ethyl 1-ethyl-5-nitro-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
|---|---|
| PubChem CID | 132584760 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl 1-ethyl-5-nitro-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=CS/C(=N\c2ccccc2)C12C(=O)N(CC)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H19N3O5S/c1-3-24-18-11-10-15(25(28)29)12-16(18)22(21(24)27)17(19(26)30-4-2)13-31-20(22)23-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3/b23-20- |
| InChIKey | NJFQVUPASOZHAI-ATJXCDBQSA-N |
| XLogP | 4.12 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|