C23H22N2O3S — CID 132584761
ethyl 1-ethyl-5-methyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate (PubChem CID 132584761) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is ethyl 1-ethyl-5-methyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate.
| Compound Name | ethyl 1-ethyl-5-methyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
|---|---|
| PubChem CID | 132584761 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl 1-ethyl-5-methyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=CS/C(=N\c2ccccc2)C12C(=O)N(CC)c1ccc(C)cc12 |
| InChI | InChI=1S/C23H22N2O3S/c1-4-25-19-12-11-15(3)13-17(19)23(22(25)27)18(20(26)28-5-2)14-29-21(23)24-16-9-7-6-8-10-16/h6-14H,4-5H2,1-3H3/b24-21- |
| InChIKey | CVAYQFODNUCRJJ-FLFQWRMESA-N |
| XLogP | 4.52 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|