C22H19ClN2O3S — CID 132584751
ethyl 6-chloro-1-ethyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate (PubChem CID 132584751) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is ethyl 6-chloro-1-ethyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate.
| Compound Name | ethyl 6-chloro-1-ethyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
|---|---|
| PubChem CID | 132584751 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 6-chloro-1-ethyl-2-oxo-5'-phenyliminospiro[indole-3,4'-thiophene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=CS/C(=N\c2ccccc2)C12C(=O)N(CC)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C22H19ClN2O3S/c1-3-25-18-12-14(23)10-11-16(18)22(21(25)27)17(19(26)28-4-2)13-29-20(22)24-15-8-6-5-7-9-15/h5-13H,3-4H2,1-2H3/b24-20- |
| InChIKey | IJDFZRBJKOGSEP-GFMRDNFCSA-N |
| XLogP | 4.87 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|