C18H15Cl2NO4 — CID 70533846
ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxoindole-3-carboxylate (PubChem CID 70533846) has the molecular formula C18H15Cl2NO4 and a molecular weight of 380.23 g/mol. Its IUPAC name is ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxoindole-3-carboxylate.
| Compound Name | ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxoindole-3-carboxylate |
|---|---|
| PubChem CID | 70533846 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxoindole-3-carboxylate |
| SMILES | CCOC(=O)C1(O)C(=O)N(Cc2ccccc2Cl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H15Cl2NO4/c1-2-25-17(23)18(24)13-9-12(19)7-8-15(13)21(16(18)22)10-11-5-3-4-6-14(11)20/h3-9,24H,2,10H2,1H3 |
| InChIKey | DKQJVKNJKGIXRF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|