C22H24N2O6 — CID 17273075
3-O'-ethyl 5-O'-prop-2-enyl 2'-amino-1-ethyl-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 17273075) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 3-O'-ethyl 5-O'-prop-2-enyl 2'-amino-1-ethyl-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | 3-O'-ethyl 5-O'-prop-2-enyl 2'-amino-1-ethyl-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 17273075 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-O'-ethyl 5-O'-prop-2-enyl 2'-amino-1-ethyl-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C(=O)OCC)C12C(=O)N(CC)c1ccccc12 |
| InChI | InChI=1S/C22H24N2O6/c1-5-12-29-19(25)16-13(4)30-18(23)17(20(26)28-7-3)22(16)14-10-8-9-11-15(14)24(6-2)21(22)27/h5,8-11H,1,6-7,12,23H2,2-4H3 |
| InChIKey | YFQSOAXDDRAUKM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|