C20H20N4O4 — CID 1215748
ethyl (4R)-6-amino-3-methyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carboxylate (PubChem CID 1215748) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl (4R)-6-amino-3-methyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carboxylate.
| Compound Name | ethyl (4R)-6-amino-3-methyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carboxylate |
|---|---|
| PubChem CID | 1215748 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | ethyl (4R)-6-amino-3-methyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carboxylate |
| SMILES | C=CCN1C(=O)[C@]2(C(C(=O)OCC)=C(N)Oc3n[nH]c(C)c32)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O4/c1-4-10-24-13-9-7-6-8-12(13)20(19(24)26)14-11(3)22-23-17(14)28-16(21)15(20)18(25)27-5-2/h4,6-9H,1,5,10,21H2,2-3H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | OHNTWAXZCMINQK-HXUWFJFHSA-N |
| XLogP | 1.66 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|