C19H17N5O2 — CID 845682
(4S)-6-amino-3-ethyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile (PubChem CID 845682) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is (4S)-6-amino-3-ethyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-ethyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
|---|---|
| PubChem CID | 845682 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (4S)-6-amino-3-ethyl-2'-oxo-1'-prop-2-enylspiro[2H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
| SMILES | C=CCN1C(=O)[C@]2(C(C#N)=C(N)Oc3n[nH]c(CC)c32)c2ccccc21 |
| InChI | InChI=1S/C19H17N5O2/c1-3-9-24-14-8-6-5-7-11(14)19(18(24)25)12(10-20)16(21)26-17-15(19)13(4-2)22-23-17/h3,5-8H,1,4,9,21H2,2H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | FCEQDJBGBNTLTD-IBGZPJMESA-N |
| XLogP | 1.88 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|