C26H24N2O6 — CID 17272946
5-O'-benzyl 3-O'-methyl 2'-amino-6'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 17272946) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 5-O'-benzyl 3-O'-methyl 2'-amino-6'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | 5-O'-benzyl 3-O'-methyl 2'-amino-6'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 17272946 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-O'-benzyl 3-O'-methyl 2'-amino-6'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | C=CCN1C(=O)C2(C(C(=O)OCc3ccccc3)=C(C)OC(N)=C2C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C26H24N2O6/c1-4-14-28-19-13-9-8-12-18(19)26(25(28)31)20(16(2)34-22(27)21(26)23(29)32-3)24(30)33-15-17-10-6-5-7-11-17/h4-13H,1,14-15,27H2,2-3H3 |
| InChIKey | RLESRMZWVROZRE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|