C26H24N2O8 — CID 3818840
dimethyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 3818840) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is dimethyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | dimethyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 3818840 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | dimethyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C(=O)OC)C12C(=O)N(CC(=O)OCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C26H24N2O8/c1-15-20(23(30)33-2)26(21(22(27)36-15)24(31)34-3)17-11-7-8-12-18(17)28(25(26)32)13-19(29)35-14-16-9-5-4-6-10-16/h4-12H,13-14,27H2,1-3H3 |
| InChIKey | XDEONPNMJZSZNZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|