C25H30N2O9 — CID 3609744
3-O'-butyl 5-O'-(2-methoxyethyl) 2'-amino-1-(2-methoxy-2-oxoethyl)-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 3609744) has the molecular formula C25H30N2O9 and a molecular weight of 502.52 g/mol. Its IUPAC name is 3-O'-butyl 5-O'-(2-methoxyethyl) 2'-amino-1-(2-methoxy-2-oxoethyl)-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | 3-O'-butyl 5-O'-(2-methoxyethyl) 2'-amino-1-(2-methoxy-2-oxoethyl)-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 3609744 |
| Molecular Formula | C25H30N2O9 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-O'-butyl 5-O'-(2-methoxyethyl) 2'-amino-1-(2-methoxy-2-oxoethyl)-6'-methyl-2-oxospiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(N)OC(C)=C(C(=O)OCCOC)C12C(=O)N(CC(=O)OC)c1ccccc12 |
| InChI | InChI=1S/C25H30N2O9/c1-5-6-11-34-23(30)20-21(26)36-15(2)19(22(29)35-13-12-32-3)25(20)16-9-7-8-10-17(16)27(24(25)31)14-18(28)33-4/h7-10H,5-6,11-14,26H2,1-4H3 |
| InChIKey | HILFENOBRMEFCI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|