C25H30N2O8 — CID 17060961
3-O'-butyl 3-O-propan-2-yl 2'-amino-1'-(2-methoxy-2-oxoethyl)-2-methyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate (PubChem CID 17060961) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-O'-butyl 3-O-propan-2-yl 2'-amino-1'-(2-methoxy-2-oxoethyl)-2-methyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate.
| Compound Name | 3-O'-butyl 3-O-propan-2-yl 2'-amino-1'-(2-methoxy-2-oxoethyl)-2-methyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
|---|---|
| PubChem CID | 17060961 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3-O'-butyl 3-O-propan-2-yl 2'-amino-1'-(2-methoxy-2-oxoethyl)-2-methyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(N)N(CC(=O)OC)c2ccccc2C12C(=O)OC(C)=C2C(=O)OC(C)C |
| InChI | InChI=1S/C25H30N2O8/c1-6-7-12-33-22(29)20-21(26)27(13-18(28)32-5)17-11-9-8-10-16(17)25(20)19(15(4)35-24(25)31)23(30)34-14(2)3/h8-11,14H,6-7,12-13,26H2,1-5H3 |
| InChIKey | JTVIBDQPXVZYAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|