C26H26N2O6 — CID 29064736
3-O'-benzyl 3-O-butyl (4S)-2-amino-2'-methyl-5'-oxospiro[1H-quinoline-4,4'-furan]-3,3'-dicarboxylate (PubChem CID 29064736) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 3-O'-benzyl 3-O-butyl (4S)-2-amino-2'-methyl-5'-oxospiro[1H-quinoline-4,4'-furan]-3,3'-dicarboxylate.
| Compound Name | 3-O'-benzyl 3-O-butyl (4S)-2-amino-2'-methyl-5'-oxospiro[1H-quinoline-4,4'-furan]-3,3'-dicarboxylate |
|---|---|
| PubChem CID | 29064736 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 3-O'-benzyl 3-O-butyl (4S)-2-amino-2'-methyl-5'-oxospiro[1H-quinoline-4,4'-furan]-3,3'-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(N)Nc2ccccc2[C@]12C(=O)OC(C)=C2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H26N2O6/c1-3-4-14-32-24(30)21-22(27)28-19-13-9-8-12-18(19)26(21)20(16(2)34-25(26)31)23(29)33-15-17-10-6-5-7-11-17/h5-13,28H,3-4,14-15,27H2,1-2H3/t26-/m1/s1 |
| InChIKey | XEBZINMQOBZVDR-AREMUKBSSA-N |
| XLogP | 3.44 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|