About butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate
butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate (PubChem CID 17060954) has the molecular formula C20H21BrN2O5
and a molecular weight of 449.30 g/mol. Its IUPAC name is butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate.
Molecular Properties
| Compound Name | butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate |
| PubChem CID | 17060954 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(N)Nc2ccc(Br)cc2C12C(=O)OC(C)=C2C(C)=O |
| InChI | InChI=1S/C20H21BrN2O5/c1-4-5-8-27-18(25)16-17(22)23-14-7-6-12(21)9-13(14)20(16)15(10(2)24)11(3)28-19(20)26/h6-7,9,23H,4-5,8,22H2,1-3H3 |
| InChIKey | LAIYXGJUUCVTKJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate?
The IUPAC name of butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate (CID 17060954) is butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate.
What is the SMILES notation for butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate?
The canonical SMILES for butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate is CCCCOC(=O)C1=C(N)Nc2ccc(Br)cc2C12C(=O)OC(C)=C2C(C)=O.
What is the InChIKey of butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate?
The InChIKey is LAIYXGJUUCVTKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21BrN2O5/c1-4-5-8-27-18(25)16-17(22)23-14-7-6-12(21)9-13(14)20(16)15(10(2)24)11(3)28-19(20)26/h6-7,9,23H,4-5,8,22H2,1-3H3.
What are the key properties of butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate?
butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate has a molecular weight of 449.30 g/mol, XLogP of 3.05, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4'-acetyl-2-amino-6-bromo-5'-methyl-2'-oxospiro[1H-quinoline-4,3'-furan]-3-carboxylate is sourced from PubChem (CID 17060954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).