C25H24N2O6 — CID 17060880
3-O-benzyl 3-O'-ethyl 2'-amino-1',2-dimethyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate (PubChem CID 17060880) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-O-benzyl 3-O'-ethyl 2'-amino-1',2-dimethyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate.
| Compound Name | 3-O-benzyl 3-O'-ethyl 2'-amino-1',2-dimethyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
|---|---|
| PubChem CID | 17060880 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-O-benzyl 3-O'-ethyl 2'-amino-1',2-dimethyl-5-oxospiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(C)c2ccccc2C12C(=O)OC(C)=C2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O6/c1-4-31-23(29)20-21(26)27(3)18-13-9-8-12-17(18)25(20)19(15(2)33-24(25)30)22(28)32-14-16-10-6-5-7-11-16/h5-13H,4,14,26H2,1-3H3 |
| InChIKey | NPSPBIRUXSPYPL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|