C22H24N2O6 — CID 29093716
diethyl (4S)-2'-amino-2-methyl-5-oxo-1'-prop-2-enylspiro[furan-4,4'-quinoline]-3,3'-dicarboxylate (PubChem CID 29093716) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is diethyl (4S)-2'-amino-2-methyl-5-oxo-1'-prop-2-enylspiro[furan-4,4'-quinoline]-3,3'-dicarboxylate.
| Compound Name | diethyl (4S)-2'-amino-2-methyl-5-oxo-1'-prop-2-enylspiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
|---|---|
| PubChem CID | 29093716 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | diethyl (4S)-2'-amino-2-methyl-5-oxo-1'-prop-2-enylspiro[furan-4,4'-quinoline]-3,3'-dicarboxylate |
| SMILES | C=CCN1C(N)=C(C(=O)OCC)[C@@]2(C(=O)OC(C)=C2C(=O)OCC)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O6/c1-5-12-24-15-11-9-8-10-14(15)22(17(18(24)23)20(26)29-7-3)16(19(25)28-6-2)13(4)30-21(22)27/h5,8-11H,1,6-7,12,23H2,2-4H3/t22-/m1/s1 |
| InChIKey | FKCTVUAEHDRLAM-JOCHJYFZSA-N |
| XLogP | 2.06 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|