C25H28N2O7 — CID 51467606
butyl (4R)-2-amino-1'-(2-ethoxy-2-oxoethyl)-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate (PubChem CID 51467606) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is butyl (4R)-2-amino-1'-(2-ethoxy-2-oxoethyl)-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate.
| Compound Name | butyl (4R)-2-amino-1'-(2-ethoxy-2-oxoethyl)-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate |
|---|---|
| PubChem CID | 51467606 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | butyl (4R)-2-amino-1'-(2-ethoxy-2-oxoethyl)-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(N)OC2=C(C(=O)CCC2)[C@@]12C(=O)N(CC(=O)OCC)c1ccccc12 |
| InChI | InChI=1S/C25H28N2O7/c1-3-5-13-33-23(30)21-22(26)34-18-12-8-11-17(28)20(18)25(21)15-9-6-7-10-16(15)27(24(25)31)14-19(29)32-4-2/h6-7,9-10H,3-5,8,11-14,26H2,1-2H3/t25-/m1/s1 |
| InChIKey | KXZCAOUOMUIART-RUZDIDTESA-N |
| XLogP | 2.38 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|